C15H15Cl2N3O3S2 — CID 2110724
1-(2,6-dichlorophenyl)sulfonyl-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide (PubChem CID 2110724) has the molecular formula C15H15Cl2N3O3S2 and a molecular weight of 420.34 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)sulfonyl-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-(2,6-dichlorophenyl)sulfonyl-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 2110724 |
| Molecular Formula | C15H15Cl2N3O3S2 |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 418.99 |
| IUPAC Name | 1-(2,6-dichlorophenyl)sulfonyl-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1nccs1)C1CCN(S(=O)(=O)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C15H15Cl2N3O3S2/c16-11-2-1-3-12(17)13(11)25(22,23)20-7-4-10(5-8-20)14(21)19-15-18-6-9-24-15/h1-3,6,9-10H,4-5,7-8H2,(H,18,19,21) |
| InChIKey | KEVJJUGLMXFTGZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |