About 4,4-difluoro-3-oxobutanal
4,4-difluoro-3-oxobutanal (PubChem CID 21107300) has the molecular formula C4H4F2O2
and a molecular weight of 122.07 g/mol. Its IUPAC name is 4,4-difluoro-3-oxobutanal.
Molecular Properties
| Compound Name | 4,4-difluoro-3-oxobutanal |
| PubChem CID | 21107300 |
| Molecular Formula | C4H4F2O2 |
| Molecular Weight | 122.07 g/mol |
| Exact Mass | 122.02 |
| IUPAC Name | 4,4-difluoro-3-oxobutanal |
| SMILES | O=CCC(=O)C(F)F |
| InChI | InChI=1S/C4H4F2O2/c5-4(6)3(8)1-2-7/h2,4H,1H2 |
| InChIKey | JDNXWZINWVTBQI-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.07 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluoro-3-oxobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-3-oxobutanal?
The IUPAC name of 4,4-difluoro-3-oxobutanal (CID 21107300) is 4,4-difluoro-3-oxobutanal.
What is the SMILES notation for 4,4-difluoro-3-oxobutanal?
The canonical SMILES for 4,4-difluoro-3-oxobutanal is O=CCC(=O)C(F)F.
What is the InChIKey of 4,4-difluoro-3-oxobutanal?
The InChIKey is JDNXWZINWVTBQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F2O2/c5-4(6)3(8)1-2-7/h2,4H,1H2.
What are the key properties of 4,4-difluoro-3-oxobutanal?
4,4-difluoro-3-oxobutanal has a molecular weight of 122.07 g/mol, XLogP of 0.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-3-oxobutanal is sourced from PubChem (CID 21107300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).