C23H28N2O2S — CID 21107508
(11S,16R)-3-[4-methoxy-2-(methoxymethyl)phenyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene (PubChem CID 21107508) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is (11S,16R)-3-[4-methoxy-2-(methoxymethyl)phenyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene.
| Compound Name | (11S,16R)-3-[4-methoxy-2-(methoxymethyl)phenyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
|---|---|
| PubChem CID | 21107508 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (11S,16R)-3-[4-methoxy-2-(methoxymethyl)phenyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
| SMILES | COCc1cc(OC)ccc1-c1cc2c3c(c1)[C@@H]1CNCC[C@@H]1N3CCCS2 |
| InChI | InChI=1S/C23H28N2O2S/c1-26-14-16-10-17(27-2)4-5-18(16)15-11-19-20-13-24-7-6-21(20)25-8-3-9-28-22(12-15)23(19)25/h4-5,10-12,20-21,24H,3,6-9,13-14H2,1-2H3/t20-,21-/m0/s1 |
| InChIKey | JYNHSKPEUJYWIZ-SFTDATJTSA-N |
| XLogP | 4.27 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |