C4H7N5OS — CID 21107588
2,5-diamino-3H-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-ol (PubChem CID 21107588) has the molecular formula C4H7N5OS and a molecular weight of 173.20 g/mol. Its IUPAC name is 2,5-diamino-3H-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-ol.
| Compound Name | 2,5-diamino-3H-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-ol |
|---|---|
| PubChem CID | 21107588 |
| Molecular Formula | C4H7N5OS |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.04 |
| IUPAC Name | 2,5-diamino-3H-[1,3]thiazolo[2,3-c][1,2,4]triazol-3-ol |
| SMILES | NC1=CSC2=NN(N)C(O)N12 |
| InChI | InChI=1S/C4H7N5OS/c5-2-1-11-3-7-9(6)4(10)8(2)3/h1,4,10H,5-6H2 |
| InChIKey | XAYDBQJAAHOKDJ-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 91.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|