About imidazo[5,1-b][1,3]thiazole-3,7-diol
imidazo[5,1-b][1,3]thiazole-3,7-diol (PubChem CID 21107714) has the molecular formula C5H4N2O2S
and a molecular weight of 156.17 g/mol. Its IUPAC name is imidazo[5,1-b][1,3]thiazole-3,7-diol.
Molecular Properties
| Compound Name | imidazo[5,1-b][1,3]thiazole-3,7-diol |
| PubChem CID | 21107714 |
| Molecular Formula | C5H4N2O2S |
| Molecular Weight | 156.17 g/mol |
| Exact Mass | 156.00 |
| IUPAC Name | imidazo[5,1-b][1,3]thiazole-3,7-diol |
| SMILES | Oc1ncn2c(O)csc12 |
| InChI | InChI=1S/C5H4N2O2S/c8-3-1-10-5-4(9)6-2-7(3)5/h1-2,8-9H |
| InChIKey | YMSYQVPXQVKKLL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 57.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze imidazo[5,1-b][1,3]thiazole-3,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[5,1-b][1,3]thiazole-3,7-diol?
The IUPAC name of imidazo[5,1-b][1,3]thiazole-3,7-diol (CID 21107714) is imidazo[5,1-b][1,3]thiazole-3,7-diol.
What is the SMILES notation for imidazo[5,1-b][1,3]thiazole-3,7-diol?
The canonical SMILES for imidazo[5,1-b][1,3]thiazole-3,7-diol is Oc1ncn2c(O)csc12.
What is the InChIKey of imidazo[5,1-b][1,3]thiazole-3,7-diol?
The InChIKey is YMSYQVPXQVKKLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O2S/c8-3-1-10-5-4(9)6-2-7(3)5/h1-2,8-9H.
What are the key properties of imidazo[5,1-b][1,3]thiazole-3,7-diol?
imidazo[5,1-b][1,3]thiazole-3,7-diol has a molecular weight of 156.17 g/mol, XLogP of 0.81, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[5,1-b][1,3]thiazole-3,7-diol is sourced from PubChem (CID 21107714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).