About pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine
pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine (PubChem CID 21107780) has the molecular formula C5H5N3S
and a molecular weight of 139.18 g/mol. Its IUPAC name is pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine.
Molecular Properties
| Compound Name | pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine |
| PubChem CID | 21107780 |
| Molecular Formula | C5H5N3S |
| Molecular Weight | 139.18 g/mol |
| Exact Mass | 139.02 |
| IUPAC Name | pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine |
| SMILES | Nc1ccn2ncsc12 |
| InChI | InChI=1S/C5H5N3S/c6-4-1-2-8-5(4)9-3-7-8/h1-3H,6H2 |
| InChIKey | ITTXFEQJDGOEKB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine?
The IUPAC name of pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine (CID 21107780) is pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine.
What is the SMILES notation for pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine?
The canonical SMILES for pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine is Nc1ccn2ncsc12.
What is the InChIKey of pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine?
The InChIKey is ITTXFEQJDGOEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3S/c6-4-1-2-8-5(4)9-3-7-8/h1-3H,6H2.
What are the key properties of pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine?
pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine has a molecular weight of 139.18 g/mol, XLogP of 0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,1-b][1,3,4]thiadiazol-7-amine is sourced from PubChem (CID 21107780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).