About pyrrolo[2,1-b][1,3]thiazol-5-amine
pyrrolo[2,1-b][1,3]thiazol-5-amine (PubChem CID 21107793) has the molecular formula C6H6N2S
and a molecular weight of 138.19 g/mol. Its IUPAC name is pyrrolo[2,1-b][1,3]thiazol-5-amine.
Molecular Properties
| Compound Name | pyrrolo[2,1-b][1,3]thiazol-5-amine |
| PubChem CID | 21107793 |
| Molecular Formula | C6H6N2S |
| Molecular Weight | 138.19 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | pyrrolo[2,1-b][1,3]thiazol-5-amine |
| SMILES | Nc1ccc2sccn12 |
| InChI | InChI=1S/C6H6N2S/c7-5-1-2-6-8(5)3-4-9-6/h1-4H,7H2 |
| InChIKey | HJWPIYJHHSCUKX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 30.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolo[2,1-b][1,3]thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[2,1-b][1,3]thiazol-5-amine?
The IUPAC name of pyrrolo[2,1-b][1,3]thiazol-5-amine (CID 21107793) is pyrrolo[2,1-b][1,3]thiazol-5-amine.
What is the SMILES notation for pyrrolo[2,1-b][1,3]thiazol-5-amine?
The canonical SMILES for pyrrolo[2,1-b][1,3]thiazol-5-amine is Nc1ccc2sccn12.
What is the InChIKey of pyrrolo[2,1-b][1,3]thiazol-5-amine?
The InChIKey is HJWPIYJHHSCUKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2S/c7-5-1-2-6-8(5)3-4-9-6/h1-4H,7H2.
What are the key properties of pyrrolo[2,1-b][1,3]thiazol-5-amine?
pyrrolo[2,1-b][1,3]thiazol-5-amine has a molecular weight of 138.19 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[2,1-b][1,3]thiazol-5-amine is sourced from PubChem (CID 21107793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).