About 3H-naphtho[1,2-f]chromene
3H-naphtho[1,2-f]chromene (PubChem CID 21107825) has the molecular formula C17H12O
and a molecular weight of 232.28 g/mol. Its IUPAC name is 3H-naphtho[1,2-f]chromene.
Molecular Properties
| Compound Name | 3H-naphtho[1,2-f]chromene |
| PubChem CID | 21107825 |
| Molecular Formula | C17H12O |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 3H-naphtho[1,2-f]chromene |
| SMILES | C1=Cc2c(ccc3ccc4ccccc4c23)OC1 |
| InChI | InChI=1S/C17H12O/c1-2-5-14-12(4-1)7-8-13-9-10-16-15(17(13)14)6-3-11-18-16/h1-10H,11H2 |
| InChIKey | UKRVFQVNIUHCKW-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3H-naphtho[1,2-f]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-naphtho[1,2-f]chromene?
The IUPAC name of 3H-naphtho[1,2-f]chromene (CID 21107825) is 3H-naphtho[1,2-f]chromene.
What is the SMILES notation for 3H-naphtho[1,2-f]chromene?
The canonical SMILES for 3H-naphtho[1,2-f]chromene is C1=Cc2c(ccc3ccc4ccccc4c23)OC1.
What is the InChIKey of 3H-naphtho[1,2-f]chromene?
The InChIKey is UKRVFQVNIUHCKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O/c1-2-5-14-12(4-1)7-8-13-9-10-16-15(17(13)14)6-3-11-18-16/h1-10H,11H2.
What are the key properties of 3H-naphtho[1,2-f]chromene?
3H-naphtho[1,2-f]chromene has a molecular weight of 232.28 g/mol, XLogP of 4.40, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-naphtho[1,2-f]chromene is sourced from PubChem (CID 21107825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).