C14H25NO — CID 21107861
2-methyl-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-en-1-one (PubChem CID 21107861) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-methyl-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-en-1-one.
| Compound Name | 2-methyl-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 21107861 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 2-methyl-1-(1,2,2,6,6-pentamethylpiperidin-4-yl)prop-2-en-1-one |
| SMILES | C=C(C)C(=O)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C14H25NO/c1-10(2)12(16)11-8-13(3,4)15(7)14(5,6)9-11/h11H,1,8-9H2,2-7H3 |
| InChIKey | GFWUYZFCCWSVGW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|