C25H27ClN2O2 — CID 21108154
(E)-1-[4-(4-chlorophenyl)piperidin-1-yl]-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)but-2-ene-1,4-dione (PubChem CID 21108154) has the molecular formula C25H27ClN2O2 and a molecular weight of 422.96 g/mol. Its IUPAC name is (E)-1-[4-(4-chlorophenyl)piperidin-1-yl]-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)but-2-ene-1,4-dione.
| Compound Name | (E)-1-[4-(4-chlorophenyl)piperidin-1-yl]-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 21108154 |
| Molecular Formula | C25H27ClN2O2 |
| Molecular Weight | 422.96 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (E)-1-[4-(4-chlorophenyl)piperidin-1-yl]-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)but-2-ene-1,4-dione |
| SMILES | O=C(/C=C/C(=O)N1CCC(c2ccc(Cl)cc2)CC1)c1ccc2c(c1)CCNCC2 |
| InChI | InChI=1S/C25H27ClN2O2/c26-23-5-3-18(4-6-23)20-11-15-28(16-12-20)25(30)8-7-24(29)22-2-1-19-9-13-27-14-10-21(19)17-22/h1-8,17,20,27H,9-16H2/b8-7+ |
| InChIKey | KYGVLUVYSCSWDM-BQYQJAHWSA-N |
| XLogP | 4.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.96 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|