C24H27N3O2S — CID 21108578
N,N-dimethyl-5-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]pent-4-yn-1-amine (PubChem CID 21108578) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is N,N-dimethyl-5-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]pent-4-yn-1-amine.
| Compound Name | N,N-dimethyl-5-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]pent-4-yn-1-amine |
|---|---|
| PubChem CID | 21108578 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N,N-dimethyl-5-[4-[5-(2-phenoxyethylsulfanylmethyl)-1,3,4-oxadiazol-2-yl]phenyl]pent-4-yn-1-amine |
| SMILES | CN(C)CCCC#Cc1ccc(-c2nnc(CSCCOc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C24H27N3O2S/c1-27(2)16-8-4-5-9-20-12-14-21(15-13-20)24-26-25-23(29-24)19-30-18-17-28-22-10-6-3-7-11-22/h3,6-7,10-15H,4,8,16-19H2,1-2H3 |
| InChIKey | GBDOXDCAYYWZQH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|