C16H13N7O — CID 21110030
N-(diaminomethylidene)-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 21110030) has the molecular formula C16H13N7O and a molecular weight of 319.33 g/mol. Its IUPAC name is N-(diaminomethylidene)-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | N-(diaminomethylidene)-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 21110030 |
| Molecular Formula | C16H13N7O |
| Molecular Weight | 319.33 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-(diaminomethylidene)-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | NC(N)=NC(=O)c1cn(-c2ccnc3[nH]ccc23)c2ncccc12 |
| InChI | InChI=1S/C16H13N7O/c17-16(18)22-15(24)11-8-23(14-9(11)2-1-5-21-14)12-4-7-20-13-10(12)3-6-19-13/h1-8H,(H,19,20)(H4,17,18,22,24) |
| InChIKey | BMYJSPBXDNTQGR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|