About methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate
methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate (PubChem CID 21110084) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate |
| PubChem CID | 21110084 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate |
| SMILES | COC(=O)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C9H8N2O2/c1-13-9(12)7-5-11-8-6(7)3-2-4-10-8/h2-5H,1H3,(H,10,11) |
| InChIKey | XYRUNIAHPKBUJT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate?
The IUPAC name of methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate (CID 21110084) is methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate.
What is the SMILES notation for methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate?
The canonical SMILES for methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate is COC(=O)c1c[nH]c2ncccc12.
What is the InChIKey of methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate?
The InChIKey is XYRUNIAHPKBUJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c1-13-9(12)7-5-11-8-6(7)3-2-4-10-8/h2-5H,1H3,(H,10,11).
What are the key properties of methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate?
methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate has a molecular weight of 176.17 g/mol, XLogP of 1.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1H-pyrrolo[2,3-b]pyridine-3-carboxylate is sourced from PubChem (CID 21110084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).