About 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine (PubChem CID 21110796) has the molecular formula C19H14Cl2F2N2O
and a molecular weight of 395.24 g/mol. Its IUPAC name is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine |
| PubChem CID | 21110796 |
| Molecular Formula | C19H14Cl2F2N2O |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine |
| SMILES | CC(Oc1cc(-c2ccc(F)cc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C19H14Cl2F2N2O/c1-10(17-14(20)6-7-15(23)18(17)21)26-16-8-12(9-25-19(16)24)11-2-4-13(22)5-3-11/h2-10H,1H3,(H2,24,25) |
| InChIKey | JHARIMMUWWVLAN-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine?
The IUPAC name of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine (CID 21110796) is 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine.
What is the SMILES notation for 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine?
The canonical SMILES for 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine is CC(Oc1cc(-c2ccc(F)cc2)cnc1N)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine?
The InChIKey is JHARIMMUWWVLAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14Cl2F2N2O/c1-10(17-14(20)6-7-15(23)18(17)21)26-16-8-12(9-25-19(16)24)11-2-4-13(22)5-3-11/h2-10H,1H3,(H2,24,25).
What are the key properties of 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine?
3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine has a molecular weight of 395.24 g/mol, XLogP of 6.06, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-(4-fluorophenyl)pyridin-2-amine is sourced from PubChem (CID 21110796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).