About 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine
3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine (PubChem CID 21111074) has the molecular formula C19H13ClF2N4O
and a molecular weight of 386.79 g/mol. Its IUPAC name is 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine |
| PubChem CID | 21111074 |
| Molecular Formula | C19H13ClF2N4O |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine |
| SMILES | Nc1ncc(-c2ccc3[nH]ccc3c2)nc1OCc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C19H13ClF2N4O/c20-17-12(13(21)2-3-14(17)22)9-27-19-18(23)25-8-16(26-19)10-1-4-15-11(7-10)5-6-24-15/h1-8,24H,9H2,(H2,23,25) |
| InChIKey | CYWZUDGGPWEFDR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine?
The IUPAC name of 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine (CID 21111074) is 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine.
What is the SMILES notation for 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine?
The canonical SMILES for 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine is Nc1ncc(-c2ccc3[nH]ccc3c2)nc1OCc1c(F)ccc(F)c1Cl.
What is the InChIKey of 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine?
The InChIKey is CYWZUDGGPWEFDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClF2N4O/c20-17-12(13(21)2-3-14(17)22)9-27-19-18(23)25-8-16(26-19)10-1-4-15-11(7-10)5-6-24-15/h1-8,24H,9H2,(H2,23,25).
What are the key properties of 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine?
3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine has a molecular weight of 386.79 g/mol, XLogP of 4.72, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-(1H-indol-5-yl)pyrazin-2-amine is sourced from PubChem (CID 21111074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).