C26H26ClF2N5O2 — CID 21111076
3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-[3-[(2,6-dimethylmorpholin-4-yl)methyl]-1H-indol-5-yl]pyrazin-2-amine (PubChem CID 21111076) has the molecular formula C26H26ClF2N5O2 and a molecular weight of 513.98 g/mol. Its IUPAC name is 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-[3-[(2,6-dimethylmorpholin-4-yl)methyl]-1H-indol-5-yl]pyrazin-2-amine.
| Compound Name | 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-[3-[(2,6-dimethylmorpholin-4-yl)methyl]-1H-indol-5-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 21111076 |
| Molecular Formula | C26H26ClF2N5O2 |
| Molecular Weight | 513.98 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | 3-[(2-chloro-3,6-difluorophenyl)methoxy]-5-[3-[(2,6-dimethylmorpholin-4-yl)methyl]-1H-indol-5-yl]pyrazin-2-amine |
| SMILES | CC1CN(Cc2c[nH]c3ccc(-c4cnc(N)c(OCc5c(F)ccc(F)c5Cl)n4)cc23)CC(C)O1 |
| InChI | InChI=1S/C26H26ClF2N5O2/c1-14-10-34(11-15(2)36-14)12-17-8-31-22-6-3-16(7-18(17)22)23-9-32-25(30)26(33-23)35-13-19-20(28)4-5-21(29)24(19)27/h3-9,14-15,31H,10-13H2,1-2H3,(H2,30,32) |
| InChIKey | YBOHYXLBMVMQBE-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.98 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|