C25H26Cl2FN5O2 — CID 21111096
(3R,5S)-3-[2-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-3,5-dimethylpiperazine-1-carbaldehyde (PubChem CID 21111096) has the molecular formula C25H26Cl2FN5O2 and a molecular weight of 518.42 g/mol. Its IUPAC name is (3R,5S)-3-[2-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-3,5-dimethylpiperazine-1-carbaldehyde.
| Compound Name | (3R,5S)-3-[2-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-3,5-dimethylpiperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 21111096 |
| Molecular Formula | C25H26Cl2FN5O2 |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | (3R,5S)-3-[2-[5-amino-6-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyrazin-2-yl]phenyl]-3,5-dimethylpiperazine-1-carbaldehyde |
| SMILES | CC(Oc1nc(-c2ccccc2[C@]2(C)CN(C=O)C[C@H](C)N2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C25H26Cl2FN5O2/c1-14-11-33(13-34)12-25(3,32-14)17-7-5-4-6-16(17)20-10-30-23(29)24(31-20)35-15(2)21-18(26)8-9-19(28)22(21)27/h4-10,13-15,32H,11-12H2,1-3H3,(H2,29,30)/t14-,15?,25-/m0/s1 |
| InChIKey | WAQPRYGRDQSOFE-DGFVBCPXSA-N |
| XLogP | 4.98 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|