About 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile
6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile (PubChem CID 21111337) has the molecular formula C14H10Cl2FN3O
and a molecular weight of 326.16 g/mol. Its IUPAC name is 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile |
| PubChem CID | 21111337 |
| Molecular Formula | C14H10Cl2FN3O |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile |
| SMILES | CC(Oc1cc(C#N)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C14H10Cl2FN3O/c1-7(12-9(15)2-3-10(17)13(12)16)21-11-4-8(5-18)6-20-14(11)19/h2-4,6-7H,1H3,(H2,19,20) |
| InChIKey | VIGFRDNZWPHYHT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile?
The IUPAC name of 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile (CID 21111337) is 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile.
What is the SMILES notation for 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile?
The canonical SMILES for 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile is CC(Oc1cc(C#N)cnc1N)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile?
The InChIKey is VIGFRDNZWPHYHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2FN3O/c1-7(12-9(15)2-3-10(17)13(12)16)21-11-4-8(5-18)6-20-14(11)19/h2-4,6-7H,1H3,(H2,19,20).
What are the key properties of 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile?
6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile has a molecular weight of 326.16 g/mol, XLogP of 4.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]pyridine-3-carbonitrile is sourced from PubChem (CID 21111337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).