C17H25NO4Si — CID 21111569
2-[2-[tert-butyl(dimethyl)silyl]oxypropoxy]isoindole-1,3-dione (PubChem CID 21111569) has the molecular formula C17H25NO4Si and a molecular weight of 335.48 g/mol. Its IUPAC name is 2-[2-[tert-butyl(dimethyl)silyl]oxypropoxy]isoindole-1,3-dione.
| Compound Name | 2-[2-[tert-butyl(dimethyl)silyl]oxypropoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 21111569 |
| Molecular Formula | C17H25NO4Si |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-[2-[tert-butyl(dimethyl)silyl]oxypropoxy]isoindole-1,3-dione |
| SMILES | CC(CON1C(=O)c2ccccc2C1=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H25NO4Si/c1-12(22-23(5,6)17(2,3)4)11-21-18-15(19)13-9-7-8-10-14(13)16(18)20/h7-10,12H,11H2,1-6H3 |
| InChIKey | GCUNXHWKISRLSW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|