About adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium
adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium (PubChem CID 21111911) has the molecular formula C31H34F2O5S2
and a molecular weight of 588.74 g/mol. Its IUPAC name is adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium.
Molecular Properties
| Compound Name | adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium |
| PubChem CID | 21111911 |
| Molecular Formula | C31H34F2O5S2 |
| Molecular Weight | 588.74 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium |
| SMILES | C1C2CC3CC1CC(C2)C3.COC(=O)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C10H16.C3H4F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-2-9-4-8(1)5-10(3-7)6-9;1-10-2(6)3(4,5)11(7,8)9/h1-15H;7-10H,1-6H2;1H3,(H,7,8,9)/q+1;;/p-1 |
| InChIKey | QCBHEDQUAFXPPD-UHFFFAOYSA-M |
| XLogP | 6.91 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.74 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium?
The IUPAC name of adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium (CID 21111911) is adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium.
What is the SMILES notation for adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium?
The canonical SMILES for adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium is C1C2CC3CC1CC(C2)C3.COC(=O)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium?
The InChIKey is QCBHEDQUAFXPPD-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15S.C10H16.C3H4F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-2-9-4-8(1)5-10(3-7)6-9;1-10-2(6)3(4,5)11(7,8)9/h1-15H;7-10H,1-6H2;1H3,(H,7,8,9)/q+1;;/p-1.
What are the key properties of adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium?
adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium has a molecular weight of 588.74 g/mol, XLogP of 6.91, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;1,1-difluoro-2-methoxy-2-oxoethanesulfonate;triphenylsulfanium is sourced from PubChem (CID 21111911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).