About 2-amino-1-ethoxyethanol
2-amino-1-ethoxyethanol (PubChem CID 21114145) has the molecular formula C4H11NO2
and a molecular weight of 105.14 g/mol. Its IUPAC name is 2-amino-1-ethoxyethanol.
Molecular Properties
| Compound Name | 2-amino-1-ethoxyethanol |
| PubChem CID | 21114145 |
| Molecular Formula | C4H11NO2 |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.08 |
| IUPAC Name | 2-amino-1-ethoxyethanol |
| SMILES | CCOC(O)CN |
| InChI | InChI=1S/C4H11NO2/c1-2-7-4(6)3-5/h4,6H,2-3,5H2,1H3 |
| InChIKey | WKJYBARSSHPINT-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-ethoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-ethoxyethanol?
The IUPAC name of 2-amino-1-ethoxyethanol (CID 21114145) is 2-amino-1-ethoxyethanol.
What is the SMILES notation for 2-amino-1-ethoxyethanol?
The canonical SMILES for 2-amino-1-ethoxyethanol is CCOC(O)CN.
What is the InChIKey of 2-amino-1-ethoxyethanol?
The InChIKey is WKJYBARSSHPINT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2/c1-2-7-4(6)3-5/h4,6H,2-3,5H2,1H3.
What are the key properties of 2-amino-1-ethoxyethanol?
2-amino-1-ethoxyethanol has a molecular weight of 105.14 g/mol, XLogP of -0.70, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-ethoxyethanol is sourced from PubChem (CID 21114145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).