C21H27FN2O2 — CID 21114298
tert-butyl N-[2-fluoro-4-[1-(1-phenylethylamino)ethyl]phenyl]carbamate (PubChem CID 21114298) has the molecular formula C21H27FN2O2 and a molecular weight of 358.46 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-4-[1-(1-phenylethylamino)ethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-4-[1-(1-phenylethylamino)ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 21114298 |
| Molecular Formula | C21H27FN2O2 |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | tert-butyl N-[2-fluoro-4-[1-(1-phenylethylamino)ethyl]phenyl]carbamate |
| SMILES | CC(NC(C)c1ccc(NC(=O)OC(C)(C)C)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C21H27FN2O2/c1-14(16-9-7-6-8-10-16)23-15(2)17-11-12-19(18(22)13-17)24-20(25)26-21(3,4)5/h6-15,23H,1-5H3,(H,24,25) |
| InChIKey | QLADMHKWHDSKRV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |