C12H13BrF6N2O2 — CID 21114627
5-bromo-2,4-bis(4,4,4-trifluorobutoxy)pyrimidine (PubChem CID 21114627) has the molecular formula C12H13BrF6N2O2 and a molecular weight of 411.14 g/mol. Its IUPAC name is 5-bromo-2,4-bis(4,4,4-trifluorobutoxy)pyrimidine.
| Compound Name | 5-bromo-2,4-bis(4,4,4-trifluorobutoxy)pyrimidine |
|---|---|
| PubChem CID | 21114627 |
| Molecular Formula | C12H13BrF6N2O2 |
| Molecular Weight | 411.14 g/mol |
| Exact Mass | 410.01 |
| IUPAC Name | 5-bromo-2,4-bis(4,4,4-trifluorobutoxy)pyrimidine |
| SMILES | FC(F)(F)CCCOc1ncc(Br)c(OCCCC(F)(F)F)n1 |
| InChI | InChI=1S/C12H13BrF6N2O2/c13-8-7-20-10(23-6-2-4-12(17,18)19)21-9(8)22-5-1-3-11(14,15)16/h7H,1-6H2 |
| InChIKey | QPQVAWHFCNQCEX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.14 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|