C10H11NO6 — CID 21114930
3,4-dimethyl-4-nitrocyclohexa-2,5-diene-1,2-dicarboxylic acid (PubChem CID 21114930) has the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. Its IUPAC name is 3,4-dimethyl-4-nitrocyclohexa-2,5-diene-1,2-dicarboxylic acid.
| Compound Name | 3,4-dimethyl-4-nitrocyclohexa-2,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 21114930 |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 3,4-dimethyl-4-nitrocyclohexa-2,5-diene-1,2-dicarboxylic acid |
| SMILES | CC1=C(C(=O)O)C(C(=O)O)C=CC1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C10H11NO6/c1-5-7(9(14)15)6(8(12)13)3-4-10(5,2)11(16)17/h3-4,6H,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | PUQRYLMZJZGFKZ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|