About CID 21115001
CID 21115001 (PubChem CID 21115001) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol.
Molecular Properties
| Compound Name | CID 21115001 |
| PubChem CID | 21115001 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | — |
| SMILES | O=[C]Cc1cccc(C[C]=O)n1 |
| InChI | InChI=1S/C9H7NO2/c11-6-4-8-2-1-3-9(10-8)5-7-12/h1-3H,4-5H2 |
| InChIKey | SXNSNPYBKVGSKN-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 21115001 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21115001?
The IUPAC name of CID 21115001 (CID 21115001) is not available.
What is the SMILES notation for CID 21115001?
The canonical SMILES for CID 21115001 is O=[C]Cc1cccc(C[C]=O)n1.
What is the InChIKey of CID 21115001?
The InChIKey is SXNSNPYBKVGSKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c11-6-4-8-2-1-3-9(10-8)5-7-12/h1-3H,4-5H2.
What are the key properties of CID 21115001?
CID 21115001 has a molecular weight of 161.16 g/mol, XLogP of 0.39, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21115001 is sourced from PubChem (CID 21115001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).