C19H24NO2+ — CID 2111518
[(2R)-oxolan-2-yl]methyl-[(2-prop-2-enoxynaphthalen-1-yl)methyl]azanium (PubChem CID 2111518) has the molecular formula C19H24NO2+ and a molecular weight of 298.41 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl-[(2-prop-2-enoxynaphthalen-1-yl)methyl]azanium.
| Compound Name | [(2R)-oxolan-2-yl]methyl-[(2-prop-2-enoxynaphthalen-1-yl)methyl]azanium |
|---|---|
| PubChem CID | 2111518 |
| Molecular Formula | C19H24NO2+ |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl-[(2-prop-2-enoxynaphthalen-1-yl)methyl]azanium |
| SMILES | C=CCOc1ccc2ccccc2c1C[NH2+]C[C@H]1CCCO1 |
| InChI | InChI=1S/C19H23NO2/c1-2-11-22-19-10-9-15-6-3-4-8-17(15)18(19)14-20-13-16-7-5-12-21-16/h2-4,6,8-10,16,20H,1,5,7,11-14H2/p+1/t16-/m1/s1 |
| InChIKey | SSWUYUKGOWYGSK-MRXNPFEDSA-O |
| XLogP | 2.65 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|