About biphenylene;methanol
biphenylene;methanol (PubChem CID 21115292) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is biphenylene;methanol.
Molecular Properties
| Compound Name | biphenylene;methanol |
| PubChem CID | 21115292 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | biphenylene;methanol |
| SMILES | CO.c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8.CH4O/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-2/h1-8H;2H,1H3 |
| InChIKey | OBKWNZDHXBLEBG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze biphenylene;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of biphenylene;methanol?
The IUPAC name of biphenylene;methanol (CID 21115292) is biphenylene;methanol.
What is the SMILES notation for biphenylene;methanol?
The canonical SMILES for biphenylene;methanol is CO.c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of biphenylene;methanol?
The InChIKey is OBKWNZDHXBLEBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.CH4O/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-2/h1-8H;2H,1H3.
What are the key properties of biphenylene;methanol?
biphenylene;methanol has a molecular weight of 184.24 g/mol, XLogP of 2.94, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for biphenylene;methanol is sourced from PubChem (CID 21115292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).