C22H16N2O7 — CID 21115492
[4-(4,8-diamino-1,5-dihydroxy-9,10-dioxoanthracen-2-yl)oxyphenyl] acetate (PubChem CID 21115492) has the molecular formula C22H16N2O7 and a molecular weight of 420.38 g/mol. Its IUPAC name is [4-(4,8-diamino-1,5-dihydroxy-9,10-dioxoanthracen-2-yl)oxyphenyl] acetate.
| Compound Name | [4-(4,8-diamino-1,5-dihydroxy-9,10-dioxoanthracen-2-yl)oxyphenyl] acetate |
|---|---|
| PubChem CID | 21115492 |
| Molecular Formula | C22H16N2O7 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | [4-(4,8-diamino-1,5-dihydroxy-9,10-dioxoanthracen-2-yl)oxyphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(Oc2cc(N)c3c(c2O)C(=O)c2c(N)ccc(O)c2C3=O)cc1 |
| InChI | InChI=1S/C22H16N2O7/c1-9(25)30-10-2-4-11(5-3-10)31-15-8-13(24)17-19(20(15)27)22(29)16-12(23)6-7-14(26)18(16)21(17)28/h2-8,26-27H,23-24H2,1H3 |
| InChIKey | KBIAWRIWEMMLTI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 162.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|