About N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride
N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride (PubChem CID 21115516) has the molecular formula C6H21Cl3N4
and a molecular weight of 255.62 g/mol. Its IUPAC name is N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride.
Molecular Properties
| Compound Name | N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride |
| PubChem CID | 21115516 |
| Molecular Formula | C6H21Cl3N4 |
| Molecular Weight | 255.62 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride |
| SMILES | Cl.Cl.Cl.NCCN(CCN)CCN |
| InChI | InChI=1S/C6H18N4.3ClH/c7-1-4-10(5-2-8)6-3-9;;;/h1-9H2;3*1H |
| InChIKey | YDJHCWNHOKBMLS-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.62 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride?
The IUPAC name of N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride (CID 21115516) is N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride.
What is the SMILES notation for N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride?
The canonical SMILES for N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride is Cl.Cl.Cl.NCCN(CCN)CCN.
What is the InChIKey of N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride?
The InChIKey is YDJHCWNHOKBMLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N4.3ClH/c7-1-4-10(5-2-8)6-3-9;;;/h1-9H2;3*1H.
What are the key properties of N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride?
N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride has a molecular weight of 255.62 g/mol, XLogP of -0.57, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-bis(2-aminoethyl)ethane-1,2-diamine;trihydrochloride is sourced from PubChem (CID 21115516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).