C8H2ClF15 — CID 21115605
1-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorooctane (PubChem CID 21115605) has the molecular formula C8H2ClF15 and a molecular weight of 418.53 g/mol. Its IUPAC name is 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorooctane.
| Compound Name | 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorooctane |
|---|---|
| PubChem CID | 21115605 |
| Molecular Formula | C8H2ClF15 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 417.96 |
| IUPAC Name | 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorooctane |
| SMILES | FCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C8H2ClF15/c9-8(23,24)7(21,22)6(19,20)5(17,18)4(15,16)3(13,14)2(11,12)1-10/h1H2 |
| InChIKey | RPCAYPDVYFWAQH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|