About 2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one
2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one (PubChem CID 21115610) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one.
Molecular Properties
| Compound Name | 2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one |
| PubChem CID | 21115610 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one |
| SMILES | CN1C(=O)C=CNC1O |
| InChI | InChI=1S/C5H8N2O2/c1-7-4(8)2-3-6-5(7)9/h2-3,5-6,9H,1H3 |
| InChIKey | HQPZNBKHYXLRNK-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one?
The IUPAC name of 2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one (CID 21115610) is 2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one.
What is the SMILES notation for 2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one?
The canonical SMILES for 2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one is CN1C(=O)C=CNC1O.
What is the InChIKey of 2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one?
The InChIKey is HQPZNBKHYXLRNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c1-7-4(8)2-3-6-5(7)9/h2-3,5-6,9H,1H3.
What are the key properties of 2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one?
2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one has a molecular weight of 128.13 g/mol, XLogP of -1.16, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-methyl-1,2-dihydropyrimidin-4-one is sourced from PubChem (CID 21115610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).