About 2-phenylethyl 2-hydroxypropanoate
2-phenylethyl 2-hydroxypropanoate (PubChem CID 21115836) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-phenylethyl 2-hydroxypropanoate.
Molecular Properties
| Compound Name | 2-phenylethyl 2-hydroxypropanoate |
| PubChem CID | 21115836 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 2-phenylethyl 2-hydroxypropanoate |
| SMILES | CC(O)C(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C11H14O3/c1-9(12)11(13)14-8-7-10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3 |
| InChIKey | IYXFDAOFSCZADY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylethyl 2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl 2-hydroxypropanoate?
The IUPAC name of 2-phenylethyl 2-hydroxypropanoate (CID 21115836) is 2-phenylethyl 2-hydroxypropanoate.
What is the SMILES notation for 2-phenylethyl 2-hydroxypropanoate?
The canonical SMILES for 2-phenylethyl 2-hydroxypropanoate is CC(O)C(=O)OCCc1ccccc1.
What is the InChIKey of 2-phenylethyl 2-hydroxypropanoate?
The InChIKey is IYXFDAOFSCZADY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-9(12)11(13)14-8-7-10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3.
What are the key properties of 2-phenylethyl 2-hydroxypropanoate?
2-phenylethyl 2-hydroxypropanoate has a molecular weight of 194.23 g/mol, XLogP of 1.15, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl 2-hydroxypropanoate is sourced from PubChem (CID 21115836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).