C30H20N4O4 — CID 21115837
7,20-diethoxy-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,18(23),19,21,24,26(30),27-tridecaene-11,16-dione (PubChem CID 21115837) has the molecular formula C30H20N4O4 and a molecular weight of 500.51 g/mol. Its IUPAC name is 7,20-diethoxy-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,18(23),19,21,24,26(30),27-tridecaene-11,16-dione.
| Compound Name | 7,20-diethoxy-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,18(23),19,21,24,26(30),27-tridecaene-11,16-dione |
|---|---|
| PubChem CID | 21115837 |
| Molecular Formula | C30H20N4O4 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 7,20-diethoxy-3,10,17,24-tetrazaoctacyclo[13.13.2.02,10.04,9.012,29.017,25.018,23.026,30]triaconta-1(29),2,4(9),5,7,12,14,18(23),19,21,24,26(30),27-tridecaene-11,16-dione |
| SMILES | CCOc1ccc2nc3c4ccc5c6c(ccc(c(=O)n3c2c1)c46)c(=O)n1c2cc(OCC)ccc2nc51 |
| InChI | InChI=1S/C30H20N4O4/c1-3-37-15-5-11-21-23(13-15)33-27(31-21)17-7-8-18-26-20(10-9-19(25(17)26)29(33)35)30(36)34-24-14-16(38-4-2)6-12-22(24)32-28(18)34/h5-14H,3-4H2,1-2H3 |
| InChIKey | UEPHXUIJCUREQH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 87.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|