C9H14O2 — CID 21116176
3-butyl-3,4-dihydropyran-2-one (PubChem CID 21116176) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 3-butyl-3,4-dihydropyran-2-one.
| Compound Name | 3-butyl-3,4-dihydropyran-2-one |
|---|---|
| PubChem CID | 21116176 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 3-butyl-3,4-dihydropyran-2-one |
| SMILES | CCCCC1CC=COC1=O |
| InChI | InChI=1S/C9H14O2/c1-2-3-5-8-6-4-7-11-9(8)10/h4,7-8H,2-3,5-6H2,1H3 |
| InChIKey | SDTSYTPZNNVAAZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |