About 7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride
7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride (PubChem CID 21116263) has the molecular formula C20H17Cl2N3
and a molecular weight of 370.28 g/mol. Its IUPAC name is 7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride.
Molecular Properties
| Compound Name | 7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride |
| PubChem CID | 21116263 |
| Molecular Formula | C20H17Cl2N3 |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride |
| SMILES | Clc1ccc2c(c1)C(c1ccccc1)=NC([n+]1ccccc1)CN2.[Cl-] |
| InChI | InChI=1S/C20H17ClN3.ClH/c21-16-9-10-18-17(13-16)20(15-7-3-1-4-8-15)23-19(14-22-18)24-11-5-2-6-12-24;/h1-13,19,22H,14H2;1H/q+1;/p-1 |
| InChIKey | HPLUTGCSAXWIMG-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 28.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride?
The IUPAC name of 7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride (CID 21116263) is 7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride.
What is the SMILES notation for 7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride?
The canonical SMILES for 7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride is Clc1ccc2c(c1)C(c1ccccc1)=NC([n+]1ccccc1)CN2.[Cl-].
What is the InChIKey of 7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride?
The InChIKey is HPLUTGCSAXWIMG-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H17ClN3.ClH/c21-16-9-10-18-17(13-16)20(15-7-3-1-4-8-15)23-19(14-22-18)24-11-5-2-6-12-24;/h1-13,19,22H,14H2;1H/q+1;/p-1.
What are the key properties of 7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride?
7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride has a molecular weight of 370.28 g/mol, XLogP of 1.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5-phenyl-3-pyridin-1-ium-1-yl-2,3-dihydro-1H-1,4-benzodiazepine chloride is sourced from PubChem (CID 21116263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).