About 2-pyridin-2-ylpyridine;hydrochloride
2-pyridin-2-ylpyridine;hydrochloride (PubChem CID 21116345) has the molecular formula C10H9ClN2
and a molecular weight of 192.65 g/mol. Its IUPAC name is 2-pyridin-2-ylpyridine;hydrochloride.
Molecular Properties
| Compound Name | 2-pyridin-2-ylpyridine;hydrochloride |
| PubChem CID | 21116345 |
| Molecular Formula | C10H9ClN2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-pyridin-2-ylpyridine;hydrochloride |
| SMILES | Cl.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.ClH/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h1-8H;1H |
| InChIKey | BYAKIEBZLGEIAF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyridin-2-ylpyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylpyridine;hydrochloride?
The IUPAC name of 2-pyridin-2-ylpyridine;hydrochloride (CID 21116345) is 2-pyridin-2-ylpyridine;hydrochloride.
What is the SMILES notation for 2-pyridin-2-ylpyridine;hydrochloride?
The canonical SMILES for 2-pyridin-2-ylpyridine;hydrochloride is Cl.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of 2-pyridin-2-ylpyridine;hydrochloride?
The InChIKey is BYAKIEBZLGEIAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.ClH/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h1-8H;1H.
What are the key properties of 2-pyridin-2-ylpyridine;hydrochloride?
2-pyridin-2-ylpyridine;hydrochloride has a molecular weight of 192.65 g/mol, XLogP of 2.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylpyridine;hydrochloride is sourced from PubChem (CID 21116345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).