C6H4Cl6 — CID 21116819
(3R,4S,5S,6R)-1,2,3,4,5,6-hexachlorocyclohexene (PubChem CID 21116819) has the molecular formula C6H4Cl6 and a molecular weight of 288.82 g/mol. Its IUPAC name is (3R,4S,5S,6R)-1,2,3,4,5,6-hexachlorocyclohexene.
| Compound Name | (3R,4S,5S,6R)-1,2,3,4,5,6-hexachlorocyclohexene |
|---|---|
| PubChem CID | 21116819 |
| Molecular Formula | C6H4Cl6 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 285.84 |
| IUPAC Name | (3R,4S,5S,6R)-1,2,3,4,5,6-hexachlorocyclohexene |
| SMILES | ClC1=C(Cl)[C@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl |
| InChI | InChI=1S/C6H4Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-4H/t1-,2-,3+,4+/m0/s1 |
| InChIKey | RTXWYBKYSKCFNF-ORZLYADOSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|