C22H35N — CID 21116896
(1R,2S,5S,6S,9R,12S,13R)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-14-ene (PubChem CID 21116896) has the molecular formula C22H35N and a molecular weight of 313.53 g/mol. Its IUPAC name is (1R,2S,5S,6S,9R,12S,13R)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-14-ene.
| Compound Name | (1R,2S,5S,6S,9R,12S,13R)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-14-ene |
|---|---|
| PubChem CID | 21116896 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | (1R,2S,5S,6S,9R,12S,13R)-6,7,13-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-14-ene |
| SMILES | C[C@H]1[C@H]2CC[C@H]3[C@@H]4CCC5CCC=C[C@]5(C)[C@H]4CC[C@]23CN1C |
| InChI | InChI=1S/C22H35N/c1-15-18-9-10-20-17-8-7-16-6-4-5-12-21(16,2)19(17)11-13-22(18,20)14-23(15)3/h5,12,15-20H,4,6-11,13-14H2,1-3H3/t15-,16?,17+,18+,19-,20-,21-,22-/m0/s1 |
| InChIKey | OYRPJLKEFMZQJL-PFKVMXGZSA-N |
| XLogP | 5.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|