About (2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate
(2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate (PubChem CID 2111702) has the molecular formula C21H20N2O5S2
and a molecular weight of 444.53 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate.
Molecular Properties
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate |
| PubChem CID | 2111702 |
| Molecular Formula | C21H20N2O5S2 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(OCc1csc(-c2ccccc2)n1)c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H20N2O5S2/c24-21(28-14-18-15-29-20(22-18)16-4-2-1-3-5-16)17-6-8-19(9-7-17)30(25,26)23-10-12-27-13-11-23/h1-9,15H,10-14H2 |
| InChIKey | MDBFAIWHZRKJAI-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate?
The IUPAC name of (2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate (CID 2111702) is (2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate.
What is the SMILES notation for (2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate?
The canonical SMILES for (2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate is O=C(OCc1csc(-c2ccccc2)n1)c1ccc(S(=O)(=O)N2CCOCC2)cc1.
What is the InChIKey of (2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate?
The InChIKey is MDBFAIWHZRKJAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O5S2/c24-21(28-14-18-15-29-20(22-18)16-4-2-1-3-5-16)17-6-8-19(9-7-17)30(25,26)23-10-12-27-13-11-23/h1-9,15H,10-14H2.
What are the key properties of (2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate?
(2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate has a molecular weight of 444.53 g/mol, XLogP of 3.19, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-1,3-thiazol-4-yl)methyl 4-morpholin-4-ylsulfonylbenzoate is sourced from PubChem (CID 2111702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).