About 2-hydroxypropanoyl 2,3-dihydroxypropanoate
2-hydroxypropanoyl 2,3-dihydroxypropanoate (PubChem CID 21117083) has the molecular formula C6H10O6
and a molecular weight of 178.14 g/mol. Its IUPAC name is 2-hydroxypropanoyl 2,3-dihydroxypropanoate.
Molecular Properties
| Compound Name | 2-hydroxypropanoyl 2,3-dihydroxypropanoate |
| PubChem CID | 21117083 |
| Molecular Formula | C6H10O6 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 2-hydroxypropanoyl 2,3-dihydroxypropanoate |
| SMILES | CC(O)C(=O)OC(=O)C(O)CO |
| InChI | InChI=1S/C6H10O6/c1-3(8)5(10)12-6(11)4(9)2-7/h3-4,7-9H,2H2,1H3 |
| InChIKey | PAQKDJFUYKNCJP-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropanoyl 2,3-dihydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropanoyl 2,3-dihydroxypropanoate?
The IUPAC name of 2-hydroxypropanoyl 2,3-dihydroxypropanoate (CID 21117083) is 2-hydroxypropanoyl 2,3-dihydroxypropanoate.
What is the SMILES notation for 2-hydroxypropanoyl 2,3-dihydroxypropanoate?
The canonical SMILES for 2-hydroxypropanoyl 2,3-dihydroxypropanoate is CC(O)C(=O)OC(=O)C(O)CO.
What is the InChIKey of 2-hydroxypropanoyl 2,3-dihydroxypropanoate?
The InChIKey is PAQKDJFUYKNCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O6/c1-3(8)5(10)12-6(11)4(9)2-7/h3-4,7-9H,2H2,1H3.
What are the key properties of 2-hydroxypropanoyl 2,3-dihydroxypropanoate?
2-hydroxypropanoyl 2,3-dihydroxypropanoate has a molecular weight of 178.14 g/mol, XLogP of -2.21, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropanoyl 2,3-dihydroxypropanoate is sourced from PubChem (CID 21117083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).