C7H3Cl7 — CID 21117279
(1S,4R,5R)-1,2,3,4,5,7,7-heptachlorobicyclo[2.2.1]hept-2-ene (PubChem CID 21117279) has the molecular formula C7H3Cl7 and a molecular weight of 335.27 g/mol. Its IUPAC name is (1S,4R,5R)-1,2,3,4,5,7,7-heptachlorobicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4R,5R)-1,2,3,4,5,7,7-heptachlorobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 21117279 |
| Molecular Formula | C7H3Cl7 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 331.81 |
| IUPAC Name | (1S,4R,5R)-1,2,3,4,5,7,7-heptachlorobicyclo[2.2.1]hept-2-ene |
| SMILES | ClC1=C(Cl)[C@]2(Cl)[C@H](Cl)C[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C7H3Cl7/c8-2-1-5(11)3(9)4(10)6(2,12)7(5,13)14/h2H,1H2/t2-,5+,6-/m1/s1 |
| InChIKey | FCMVPUGRXPEIQX-LOHQWYEISA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|