C14H23N3O4 — CID 21117437
butan-2-ylcarbamic acid;3-(3-hydroxyphenyl)-1,1-dimethylurea (PubChem CID 21117437) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is butan-2-ylcarbamic acid;3-(3-hydroxyphenyl)-1,1-dimethylurea.
| Compound Name | butan-2-ylcarbamic acid;3-(3-hydroxyphenyl)-1,1-dimethylurea |
|---|---|
| PubChem CID | 21117437 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | butan-2-ylcarbamic acid;3-(3-hydroxyphenyl)-1,1-dimethylurea |
| SMILES | CCC(C)NC(=O)O.CN(C)C(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C9H12N2O2.C5H11NO2/c1-11(2)9(13)10-7-4-3-5-8(12)6-7;1-3-4(2)6-5(7)8/h3-6,12H,1-2H3,(H,10,13);4,6H,3H2,1-2H3,(H,7,8) |
| InChIKey | JULQMWGWZQKWPH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |