About trichloromethylstannane
trichloromethylstannane (PubChem CID 21117671) has the molecular formula CH3Cl3Sn
and a molecular weight of 240.10 g/mol. Its IUPAC name is trichloromethylstannane.
Molecular Properties
| Compound Name | trichloromethylstannane |
| PubChem CID | 21117671 |
| Molecular Formula | CH3Cl3Sn |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.83 |
| IUPAC Name | trichloromethylstannane |
| SMILES | ClC(Cl)(Cl)[SnH3] |
| InChI | InChI=1S/CCl3.Sn.3H/c2-1(3)4;;;; |
| InChIKey | ZQSSJDDYOYHPRM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze trichloromethylstannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloromethylstannane?
The IUPAC name of trichloromethylstannane (CID 21117671) is trichloromethylstannane.
What is the SMILES notation for trichloromethylstannane?
The canonical SMILES for trichloromethylstannane is ClC(Cl)(Cl)[SnH3].
What is the InChIKey of trichloromethylstannane?
The InChIKey is ZQSSJDDYOYHPRM-UHFFFAOYSA-N. The full InChI is InChI=1S/CCl3.Sn.3H/c2-1(3)4;;;;.
What are the key properties of trichloromethylstannane?
trichloromethylstannane has a molecular weight of 240.10 g/mol, XLogP of 0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trichloromethylstannane is sourced from PubChem (CID 21117671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).