C12H25O2P — CID 21117725
2,4,6-tri(propan-2-yl)-1,3,2-dioxaphosphinane (PubChem CID 21117725) has the molecular formula C12H25O2P and a molecular weight of 232.30 g/mol. Its IUPAC name is 2,4,6-tri(propan-2-yl)-1,3,2-dioxaphosphinane.
| Compound Name | 2,4,6-tri(propan-2-yl)-1,3,2-dioxaphosphinane |
|---|---|
| PubChem CID | 21117725 |
| Molecular Formula | C12H25O2P |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 2,4,6-tri(propan-2-yl)-1,3,2-dioxaphosphinane |
| SMILES | CC(C)C1CC(C(C)C)OP(C(C)C)O1 |
| InChI | InChI=1S/C12H25O2P/c1-8(2)11-7-12(9(3)4)14-15(13-11)10(5)6/h8-12H,7H2,1-6H3 |
| InChIKey | YLEBHTZHRYJPKZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|