About benzyl (2S)-2-anilinopropanoate
benzyl (2S)-2-anilinopropanoate (PubChem CID 21117728) has the molecular formula C16H17NO2
and a molecular weight of 255.32 g/mol. Its IUPAC name is benzyl (2S)-2-anilinopropanoate.
Molecular Properties
| Compound Name | benzyl (2S)-2-anilinopropanoate |
| PubChem CID | 21117728 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | benzyl (2S)-2-anilinopropanoate |
| SMILES | C[C@H](Nc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c1-13(17-15-10-6-3-7-11-15)16(18)19-12-14-8-4-2-5-9-14/h2-11,13,17H,12H2,1H3/t13-/m0/s1 |
| InChIKey | RWDFLSLCMUWNPX-ZDUSSCGKSA-N |
| XLogP | 3.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl (2S)-2-anilinopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2S)-2-anilinopropanoate?
The IUPAC name of benzyl (2S)-2-anilinopropanoate (CID 21117728) is benzyl (2S)-2-anilinopropanoate.
What is the SMILES notation for benzyl (2S)-2-anilinopropanoate?
The canonical SMILES for benzyl (2S)-2-anilinopropanoate is C[C@H](Nc1ccccc1)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl (2S)-2-anilinopropanoate?
The InChIKey is RWDFLSLCMUWNPX-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H17NO2/c1-13(17-15-10-6-3-7-11-15)16(18)19-12-14-8-4-2-5-9-14/h2-11,13,17H,12H2,1H3/t13-/m0/s1.
What are the key properties of benzyl (2S)-2-anilinopropanoate?
benzyl (2S)-2-anilinopropanoate has a molecular weight of 255.32 g/mol, XLogP of 3.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S)-2-anilinopropanoate is sourced from PubChem (CID 21117728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).