C10H17NO — CID 21118359
2-Buten-1-one, 2-methyl-1-(1-piperidinyl)- (PubChem CID 21118359) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (E)-2-methyl-1-piperidin-1-ylbut-2-en-1-one.
| Compound Name | 2-Buten-1-one, 2-methyl-1-(1-piperidinyl)- |
|---|---|
| PubChem CID | 21118359 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (E)-2-methyl-1-piperidin-1-ylbut-2-en-1-one |
| SMILES | C/C=C(\C)/C(=O)N1CCCCC1 |
| InChI | InChI=1S/C10H17NO/c1-3-9(2)10(12)11-7-5-4-6-8-11/h3H,4-8H2,1-2H3/b9-3+ |
| InChIKey | AASUNBIGKXSKNF-YCRREMRBSA-N |
| XLogP | 1.80 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 190 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|