About 2-aminooxyacetamide;hydrochloride
2-aminooxyacetamide;hydrochloride (PubChem CID 21118417) has the molecular formula C2H7ClN2O2
and a molecular weight of 126.54 g/mol. Its IUPAC name is 2-aminooxyacetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-aminooxyacetamide;hydrochloride |
| PubChem CID | 21118417 |
| Molecular Formula | C2H7ClN2O2 |
| Molecular Weight | 126.54 g/mol |
| Exact Mass | 126.02 |
| IUPAC Name | 2-aminooxyacetamide;hydrochloride |
| SMILES | Cl.NOCC(N)=O |
| InChI | InChI=1S/C2H6N2O2.ClH/c3-2(5)1-6-4;/h1,4H2,(H2,3,5);1H |
| InChIKey | BIUQVFWWPLIJJU-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.54 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-aminooxyacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminooxyacetamide;hydrochloride?
The IUPAC name of 2-aminooxyacetamide;hydrochloride (CID 21118417) is 2-aminooxyacetamide;hydrochloride.
What is the SMILES notation for 2-aminooxyacetamide;hydrochloride?
The canonical SMILES for 2-aminooxyacetamide;hydrochloride is Cl.NOCC(N)=O.
What is the InChIKey of 2-aminooxyacetamide;hydrochloride?
The InChIKey is BIUQVFWWPLIJJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O2.ClH/c3-2(5)1-6-4;/h1,4H2,(H2,3,5);1H.
What are the key properties of 2-aminooxyacetamide;hydrochloride?
2-aminooxyacetamide;hydrochloride has a molecular weight of 126.54 g/mol, XLogP of -1.22, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminooxyacetamide;hydrochloride is sourced from PubChem (CID 21118417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).