About CID 21118778
CID 21118778 (PubChem CID 21118778) has the molecular formula C21H30O5Pb
and a molecular weight of 569.67 g/mol.
Molecular Properties
| Compound Name | CID 21118778 |
| PubChem CID | 21118778 |
| Molecular Formula | C21H30O5Pb |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 570.19 |
| IUPAC Name | — |
| SMILES | CC(C)=CCC1=C(O)C(CC(=O)C(C)C)=C(O)[C@@](O)(CC=C(C)C)C1=O.[Pb] |
| InChI | InChI=1S/C21H30O5.Pb/c1-12(2)7-8-15-18(23)16(11-17(22)14(5)6)20(25)21(26,19(15)24)10-9-13(3)4;/h7,9,14,23,25-26H,8,10-11H2,1-6H3;/t21-;/m1./s1 |
| InChIKey | URIACQYFDFQCCR-ZMBIFBSDSA-N |
| XLogP | 3.87 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 21118778 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21118778?
The IUPAC name of CID 21118778 (CID 21118778) is not available.
What is the SMILES notation for CID 21118778?
The canonical SMILES for CID 21118778 is CC(C)=CCC1=C(O)C(CC(=O)C(C)C)=C(O)[C@@](O)(CC=C(C)C)C1=O.[Pb].
What is the InChIKey of CID 21118778?
The InChIKey is URIACQYFDFQCCR-ZMBIFBSDSA-N. The full InChI is InChI=1S/C21H30O5.Pb/c1-12(2)7-8-15-18(23)16(11-17(22)14(5)6)20(25)21(26,19(15)24)10-9-13(3)4;/h7,9,14,23,25-26H,8,10-11H2,1-6H3;/t21-;/m1./s1.
What are the key properties of CID 21118778?
CID 21118778 has a molecular weight of 569.67 g/mol, XLogP of 3.87, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21118778 is sourced from PubChem (CID 21118778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).