About 2-hydroxy-3,4-di(nonyl)benzenesulfonic acid
2-hydroxy-3,4-di(nonyl)benzenesulfonic acid (PubChem CID 21118824) has the molecular formula C24H42O4S
and a molecular weight of 426.66 g/mol. Its IUPAC name is 2-hydroxy-3,4-di(nonyl)benzenesulfonic acid.
Molecular Properties
| Compound Name | 2-hydroxy-3,4-di(nonyl)benzenesulfonic acid |
| PubChem CID | 21118824 |
| Molecular Formula | C24H42O4S |
| Molecular Weight | 426.66 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 2-hydroxy-3,4-di(nonyl)benzenesulfonic acid |
| SMILES | CCCCCCCCCc1ccc(S(=O)(=O)O)c(O)c1CCCCCCCCC |
| InChI | InChI=1S/C24H42O4S/c1-3-5-7-9-11-13-15-17-21-19-20-23(29(26,27)28)24(25)22(21)18-16-14-12-10-8-6-4-2/h19-20,25H,3-18H2,1-2H3,(H,26,27,28) |
| InChIKey | ZPAOFJRSHDHADM-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.66 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3,4-di(nonyl)benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3,4-di(nonyl)benzenesulfonic acid?
The IUPAC name of 2-hydroxy-3,4-di(nonyl)benzenesulfonic acid (CID 21118824) is 2-hydroxy-3,4-di(nonyl)benzenesulfonic acid.
What is the SMILES notation for 2-hydroxy-3,4-di(nonyl)benzenesulfonic acid?
The canonical SMILES for 2-hydroxy-3,4-di(nonyl)benzenesulfonic acid is CCCCCCCCCc1ccc(S(=O)(=O)O)c(O)c1CCCCCCCCC.
What is the InChIKey of 2-hydroxy-3,4-di(nonyl)benzenesulfonic acid?
The InChIKey is ZPAOFJRSHDHADM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O4S/c1-3-5-7-9-11-13-15-17-21-19-20-23(29(26,27)28)24(25)22(21)18-16-14-12-10-8-6-4-2/h19-20,25H,3-18H2,1-2H3,(H,26,27,28).
What are the key properties of 2-hydroxy-3,4-di(nonyl)benzenesulfonic acid?
2-hydroxy-3,4-di(nonyl)benzenesulfonic acid has a molecular weight of 426.66 g/mol, XLogP of 7.23, 17 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3,4-di(nonyl)benzenesulfonic acid is sourced from PubChem (CID 21118824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).