C31H36Br2N4+2 — CID 21119205
9-[5-(1,2-dimethyl-2H-pyrido[3,4-b]indole-2,9-diium-9-yl)pentyl]-1,2-dimethyl-2H-pyrido[3,4-b]indole-2,9-diium dibromide (PubChem CID 21119205) has the molecular formula C31H36Br2N4+2 and a molecular weight of 624.47 g/mol. Its IUPAC name is 9-[5-(1,2-dimethyl-2H-pyrido[3,4-b]indole-2,9-diium-9-yl)pentyl]-1,2-dimethyl-2H-pyrido[3,4-b]indole-2,9-diium dibromide.
| Compound Name | 9-[5-(1,2-dimethyl-2H-pyrido[3,4-b]indole-2,9-diium-9-yl)pentyl]-1,2-dimethyl-2H-pyrido[3,4-b]indole-2,9-diium dibromide |
|---|---|
| PubChem CID | 21119205 |
| Molecular Formula | C31H36Br2N4+2 |
| Molecular Weight | 624.47 g/mol |
| Exact Mass | 622.13 |
| IUPAC Name | 9-[5-(1,2-dimethyl-2H-pyrido[3,4-b]indole-2,9-diium-9-yl)pentyl]-1,2-dimethyl-2H-pyrido[3,4-b]indole-2,9-diium dibromide |
| SMILES | CC1=C2C(=c3ccccc3=[N+]2CCCCC[N+]2=c3ccccc3=C3C=C[NH+](C)C(C)=C32)C=C[NH+]1C.[Br-].[Br-] |
| InChI | InChI=1S/C31H34N4.2BrH/c1-22-30-26(16-20-32(22)3)24-12-6-8-14-28(24)34(30)18-10-5-11-19-35-29-15-9-7-13-25(29)27-17-21-33(4)23(2)31(27)35;;/h6-9,12-17,20-21H,5,10-11,18-19H2,1-4H3;2*1H/q+2;; |
| InChIKey | WHAOWHPJJKDJEN-UHFFFAOYSA-N |
| XLogP | -6.58 |
| TPSA | 14.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.47 |
| LogP ≤ 5 | -6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|